C36H44ClN5O8 — CID 144853127
N-[2-[2-[2-[2-[2-[2-[[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-hydroxybenzamide (PubChem CID 144853127) has the molecular formula C36H44ClN5O8 and a molecular weight of 710.23 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-[2-[[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[2-[2-[2-[2-[2-[[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 144853127 |
| Molecular Formula | C36H44ClN5O8 |
| Molecular Weight | 710.23 g/mol |
| Exact Mass | 709.29 |
| IUPAC Name | N-[2-[2-[2-[2-[2-[2-[[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2-hydroxybenzamide |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(Cl)cc2)c2cc(OCCOCCOCCOCCOCCOCCNC(=O)c3ccccc3O)ccc21 |
| InChI | InChI=1S/C36H44ClN5O8/c1-26(38)42-32-11-10-29(24-31(32)35(41-25-34(42)39)27-6-8-28(37)9-7-27)50-23-22-49-21-20-48-19-18-47-17-16-46-15-14-45-13-12-40-36(44)30-4-2-3-5-33(30)43/h2-11,24,38-39,43H,12-23,25H2,1H3,(H,40,44)/b38-26+,39-34+ |
| InChIKey | KLSOQJJOHKXPCA-MIRCKECGSA-N |
| XLogP | 4.57 |
| TPSA | 168.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|