C29H33ClN6O2 — CID 144545974
[2-[[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]oxymethyl]phenyl]methanamine;N-ethylacetamide (PubChem CID 144545974) has the molecular formula C29H33ClN6O2 and a molecular weight of 533.08 g/mol. Its IUPAC name is [2-[[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]oxymethyl]phenyl]methanamine;N-ethylacetamide.
| Compound Name | [2-[[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]oxymethyl]phenyl]methanamine;N-ethylacetamide |
|---|---|
| PubChem CID | 144545974 |
| Molecular Formula | C29H33ClN6O2 |
| Molecular Weight | 533.08 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | [2-[[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]oxymethyl]phenyl]methanamine;N-ethylacetamide |
| SMILES | CCNC(C)=O.[H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(Cl)cc2)c2cc(OCc3ccccc3CN)ccc21 |
| InChI | InChI=1S/C25H24ClN5O.C4H9NO/c1-16(28)31-23-11-10-21(32-15-19-5-3-2-4-18(19)13-27)12-22(23)25(30-14-24(31)29)17-6-8-20(26)9-7-17;1-3-5-4(2)6/h2-12,28-29H,13-15,27H2,1H3;3H2,1-2H3,(H,5,6)/b28-16+,29-24+; |
| InChIKey | DPUUKJKYKJCARM-UPDZXXSXSA-N |
| XLogP | 5.15 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.08 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|