C18H18N4OS — CID 137161099
4-(1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-5-yl)benzenethiol (PubChem CID 137161099) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 4-(1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-5-yl)benzenethiol.
| Compound Name | 4-(1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-5-yl)benzenethiol |
|---|---|
| PubChem CID | 137161099 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-(1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-5-yl)benzenethiol |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(S)cc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C18H18N4OS/c1-11(19)22-16-8-5-13(23-2)9-15(16)18(21-10-17(22)20)12-3-6-14(24)7-4-12/h3-9,19-20,24H,10H2,1-2H3/b19-11+,20-17+ |
| InChIKey | WTWCPYMTBOAYHK-HPCQEULDSA-N |
| XLogP | 3.62 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|