C27H28BClFN5O3 — CID 162724468
[5-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]-2-fluorophenyl]boronic acid;N-ethylacetamide (PubChem CID 162724468) has the molecular formula C27H28BClFN5O3 and a molecular weight of 535.82 g/mol. Its IUPAC name is [5-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]-2-fluorophenyl]boronic acid;N-ethylacetamide.
| Compound Name | [5-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]-2-fluorophenyl]boronic acid;N-ethylacetamide |
|---|---|
| PubChem CID | 162724468 |
| Molecular Formula | C27H28BClFN5O3 |
| Molecular Weight | 535.82 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | [5-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-3H-1,4-benzodiazepin-7-yl]-2-fluorophenyl]boronic acid;N-ethylacetamide |
| SMILES | CCNC(C)=O.[H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(Cl)cc2)c2cc(-c3ccc(F)c(B(O)O)c3)ccc21 |
| InChI | InChI=1S/C23H19BClFN4O2.C4H9NO/c1-13(27)30-21-9-5-15(16-4-8-20(26)19(11-16)24(31)32)10-18(21)23(29-12-22(30)28)14-2-6-17(25)7-3-14;1-3-5-4(2)6/h2-11,27-28,31-32H,12H2,1H3;3H2,1-2H3,(H,5,6)/b27-13+,28-22+; |
| InChIKey | IADFHMSBQVYOBV-AHWJVSAJSA-N |
| XLogP | 3.60 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.82 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|