C28H34ClN5OS — CID 176970176
5-(4-chlorophenyl)-1-ethanimidoyl-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-2-imine;ethane;N-(4-methylphenyl)acetamide (PubChem CID 176970176) has the molecular formula C28H34ClN5OS and a molecular weight of 524.13 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-ethanimidoyl-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-2-imine;ethane;N-(4-methylphenyl)acetamide.
| Compound Name | 5-(4-chlorophenyl)-1-ethanimidoyl-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-2-imine;ethane;N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 176970176 |
| Molecular Formula | C28H34ClN5OS |
| Molecular Weight | 524.13 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 5-(4-chlorophenyl)-1-ethanimidoyl-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-2-imine;ethane;N-(4-methylphenyl)acetamide |
| SMILES | CC.CC(=O)Nc1ccc(C)cc1.[H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(Cl)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C17H17ClN4S.C9H11NO.C2H6/c1-9-10(2)23-17-15(9)16(12-4-6-13(18)7-5-12)21-8-14(20)22(17)11(3)19;1-7-3-5-9(6-4-7)10-8(2)11;1-2/h4-7,19-20H,8H2,1-3H3;3-6H,1-2H3,(H,10,11);1-2H3/b19-11+,20-14+;; |
| InChIKey | WOLOBRILGVOIBP-MVUZJGQQSA-N |
| XLogP | 7.63 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.13 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|