C23H28ClN7OS — CID 164755822
1-(4-aminopiperazin-1-yl)-2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]ethanone (PubChem CID 164755822) has the molecular formula C23H28ClN7OS and a molecular weight of 486.05 g/mol. Its IUPAC name is 1-(4-aminopiperazin-1-yl)-2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]ethanone.
| Compound Name | 1-(4-aminopiperazin-1-yl)-2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]ethanone |
|---|---|
| PubChem CID | 164755822 |
| Molecular Formula | C23H28ClN7OS |
| Molecular Weight | 486.05 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 1-(4-aminopiperazin-1-yl)-2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]ethanone |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)N2CCN(N)CC2)N=C(c2ccc(Cl)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C23H28ClN7OS/c1-13-14(2)33-23-20(13)21(16-4-6-17(24)7-5-16)28-18(22(26)31(23)15(3)25)12-19(32)29-8-10-30(27)11-9-29/h4-7,18,25-26H,8-12,27H2,1-3H3/b25-15+,26-22+/t18-/m0/s1 |
| InChIKey | WFNTYTGFLHUIIP-OYQGLMNWSA-N |
| XLogP | 3.43 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.05 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|