C24H28ClN5O4S — CID 169247265
3-[2-[[2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetyl]amino]ethoxy]propanoic acid (PubChem CID 169247265) has the molecular formula C24H28ClN5O4S and a molecular weight of 518.04 g/mol. Its IUPAC name is 3-[2-[[2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetyl]amino]ethoxy]propanoic acid.
| Compound Name | 3-[2-[[2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetyl]amino]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 169247265 |
| Molecular Formula | C24H28ClN5O4S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 3-[2-[[2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetyl]amino]ethoxy]propanoic acid |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)NCCOCCC(=O)O)N=C(c2ccc(Cl)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C24H28ClN5O4S/c1-13-14(2)35-24-21(13)22(16-4-6-17(25)7-5-16)29-18(23(27)30(24)15(3)26)12-19(31)28-9-11-34-10-8-20(32)33/h4-7,18,26-27H,8-12H2,1-3H3,(H,28,31)(H,32,33)/b26-15+,27-23+/t18-/m0/s1 |
| InChIKey | MWNGIHKMGUPOSY-ORMDTJOUSA-N |
| XLogP | 4.02 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|