C30H31ClN4O4S — CID 171795206
methyl 4-[1-[3-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]propanoyloxy]ethyl]benzoate (PubChem CID 171795206) has the molecular formula C30H31ClN4O4S and a molecular weight of 579.12 g/mol. Its IUPAC name is methyl 4-[1-[3-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]propanoyloxy]ethyl]benzoate.
| Compound Name | methyl 4-[1-[3-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]propanoyloxy]ethyl]benzoate |
|---|---|
| PubChem CID | 171795206 |
| Molecular Formula | C30H31ClN4O4S |
| Molecular Weight | 579.12 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | methyl 4-[1-[3-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]propanoyloxy]ethyl]benzoate |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])C(CCC(=O)OC(C)c2ccc(C(=O)OC)cc2)N=C(c2ccc(Cl)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C30H31ClN4O4S/c1-16-18(3)40-29-26(16)27(21-10-12-23(31)13-11-21)34-24(28(33)35(29)19(4)32)14-15-25(36)39-17(2)20-6-8-22(9-7-20)30(37)38-5/h6-13,17,24,32-33H,14-15H2,1-5H3/b32-19+,33-28+ |
| InChIKey | OOVSWRBNHYPPHS-DOAMVSPWSA-N |
| XLogP | 6.89 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.12 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|