C34H41N5O5S — CID 146294940
tert-butyl 2-[3-[4-[(3S)-3-(2-anilino-2-oxoethyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-5-yl]phenoxy]propoxy]acetate (PubChem CID 146294940) has the molecular formula C34H41N5O5S and a molecular weight of 631.80 g/mol. Its IUPAC name is tert-butyl 2-[3-[4-[(3S)-3-(2-anilino-2-oxoethyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-5-yl]phenoxy]propoxy]acetate.
| Compound Name | tert-butyl 2-[3-[4-[(3S)-3-(2-anilino-2-oxoethyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-5-yl]phenoxy]propoxy]acetate |
|---|---|
| PubChem CID | 146294940 |
| Molecular Formula | C34H41N5O5S |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | tert-butyl 2-[3-[4-[(3S)-3-(2-anilino-2-oxoethyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-5-yl]phenoxy]propoxy]acetate |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)Nc2ccccc2)N=C(c2ccc(OCCCOCC(=O)OC(C)(C)C)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C34H41N5O5S/c1-21-22(2)45-33-30(21)31(24-13-15-26(16-14-24)43-18-10-17-42-20-29(41)44-34(4,5)6)38-27(32(36)39(33)23(3)35)19-28(40)37-25-11-8-7-9-12-25/h7-9,11-16,27,35-36H,10,17-20H2,1-6H3,(H,37,40)/b35-23+,36-32+/t27-/m0/s1 |
| InChIKey | FKMFAIRWDZTKSB-DTNNZRKKSA-N |
| XLogP | 6.52 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|