C24H29ClN4O2S — CID 178006003
tert-butyl 2-[(3S)-5-(5-chlorocyclohepta-1,4,6-trien-1-yl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate (PubChem CID 178006003) has the molecular formula C24H29ClN4O2S and a molecular weight of 473.04 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-5-(5-chlorocyclohepta-1,4,6-trien-1-yl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-5-(5-chlorocyclohepta-1,4,6-trien-1-yl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
|---|---|
| PubChem CID | 178006003 |
| Molecular Formula | C24H29ClN4O2S |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | tert-butyl 2-[(3S)-5-(5-chlorocyclohepta-1,4,6-trien-1-yl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)OC(C)(C)C)N=C(C2=CCC=C(Cl)C=C2)c2c1sc(C)c2C |
| InChI | InChI=1S/C24H29ClN4O2S/c1-13-14(2)32-23-20(13)21(16-8-7-9-17(25)11-10-16)28-18(22(27)29(23)15(3)26)12-19(30)31-24(4,5)6/h8-11,18,26-27H,7,12H2,1-6H3/b26-15+,27-22+/t18-/m0/s1 |
| InChIKey | QQAZETNGRZYNRV-FPUNGRBVSA-N |
| XLogP | 6.06 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|