C23H29ClN4O2S — CID 146479056
tert-butyl 2-[(3S)-2-amino-5-(4-chlorophenyl)-1-ethanimidoyl-6,7-dimethyl-2,3-dihydrothieno[2,3-e][1,4]diazepin-3-yl]acetate (PubChem CID 146479056) has the molecular formula C23H29ClN4O2S and a molecular weight of 461.03 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-2-amino-5-(4-chlorophenyl)-1-ethanimidoyl-6,7-dimethyl-2,3-dihydrothieno[2,3-e][1,4]diazepin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-2-amino-5-(4-chlorophenyl)-1-ethanimidoyl-6,7-dimethyl-2,3-dihydrothieno[2,3-e][1,4]diazepin-3-yl]acetate |
|---|---|
| PubChem CID | 146479056 |
| Molecular Formula | C23H29ClN4O2S |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | tert-butyl 2-[(3S)-2-amino-5-(4-chlorophenyl)-1-ethanimidoyl-6,7-dimethyl-2,3-dihydrothieno[2,3-e][1,4]diazepin-3-yl]acetate |
| SMILES | [H]/N=C(\C)N1c2sc(C)c(C)c2C(c2ccc(Cl)cc2)=N[C@@H](CC(=O)OC(C)(C)C)C1N |
| InChI | InChI=1S/C23H29ClN4O2S/c1-12-13(2)31-22-19(12)20(15-7-9-16(24)10-8-15)27-17(21(26)28(22)14(3)25)11-18(29)30-23(4,5)6/h7-10,17,21,25H,11,26H2,1-6H3/b25-14+/t17-,21?/m0/s1 |
| InChIKey | FGOJZLOAJTVMBO-WTBFEEFLSA-N |
| XLogP | 5.06 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|