C23H24ClF3N4O2S — CID 144913658
tert-butyl 2-[5-(4-chlorophenyl)-2-imino-6,7-dimethyl-1-(2,2,2-trifluoroethanimidoyl)-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate (PubChem CID 144913658) has the molecular formula C23H24ClF3N4O2S and a molecular weight of 512.99 g/mol. Its IUPAC name is tert-butyl 2-[5-(4-chlorophenyl)-2-imino-6,7-dimethyl-1-(2,2,2-trifluoroethanimidoyl)-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate.
| Compound Name | tert-butyl 2-[5-(4-chlorophenyl)-2-imino-6,7-dimethyl-1-(2,2,2-trifluoroethanimidoyl)-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
|---|---|
| PubChem CID | 144913658 |
| Molecular Formula | C23H24ClF3N4O2S |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | tert-butyl 2-[5-(4-chlorophenyl)-2-imino-6,7-dimethyl-1-(2,2,2-trifluoroethanimidoyl)-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
| SMILES | [H]/N=C1\C(CC(=O)OC(C)(C)C)N=C(c2ccc(Cl)cc2)c2c(sc(C)c2C)N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C23H24ClF3N4O2S/c1-11-12(2)34-20-17(11)18(13-6-8-14(24)9-7-13)30-15(10-16(32)33-22(3,4)5)19(28)31(20)21(29)23(25,26)27/h6-9,15,28-29H,10H2,1-5H3/b28-19+,29-21+ |
| InChIKey | BYMKYCJTJTWWBF-NEYXXFTDSA-N |
| XLogP | 6.29 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|