C26H33N5O3S — CID 177093009
tert-butyl 2-[(3S)-1-ethanimidoyl-5-[4-[(E)-3-(hydroxyamino)prop-1-enyl]phenyl]-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate (PubChem CID 177093009) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-1-ethanimidoyl-5-[4-[(E)-3-(hydroxyamino)prop-1-enyl]phenyl]-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-1-ethanimidoyl-5-[4-[(E)-3-(hydroxyamino)prop-1-enyl]phenyl]-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
|---|---|
| PubChem CID | 177093009 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | tert-butyl 2-[(3S)-1-ethanimidoyl-5-[4-[(E)-3-(hydroxyamino)prop-1-enyl]phenyl]-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)OC(C)(C)C)N=C(c2ccc(/C=C/CNO)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C26H33N5O3S/c1-15-16(2)35-25-22(15)23(19-11-9-18(10-12-19)8-7-13-29-33)30-20(24(28)31(25)17(3)27)14-21(32)34-26(4,5)6/h7-12,20,27-29,33H,13-14H2,1-6H3/b8-7+,27-17+,28-24+/t20-/m0/s1 |
| InChIKey | LQAUMSZRGWOBRQ-IJSKGDAOSA-N |
| XLogP | 5.09 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|