C27H31N5O3S — CID 177093022
(3-methyloxetan-3-yl)methyl 2-[(3S)-5-[4-(3-aminoprop-1-ynyl)phenyl]-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate (PubChem CID 177093022) has the molecular formula C27H31N5O3S and a molecular weight of 505.64 g/mol. Its IUPAC name is (3-methyloxetan-3-yl)methyl 2-[(3S)-5-[4-(3-aminoprop-1-ynyl)phenyl]-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate.
| Compound Name | (3-methyloxetan-3-yl)methyl 2-[(3S)-5-[4-(3-aminoprop-1-ynyl)phenyl]-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
|---|---|
| PubChem CID | 177093022 |
| Molecular Formula | C27H31N5O3S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | (3-methyloxetan-3-yl)methyl 2-[(3S)-5-[4-(3-aminoprop-1-ynyl)phenyl]-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)OCC2(C)COC2)N=C(c2ccc(C#CCN)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C27H31N5O3S/c1-16-17(2)36-26-23(16)24(20-9-7-19(8-10-20)6-5-11-28)31-21(25(30)32(26)18(3)29)12-22(33)35-15-27(4)13-34-14-27/h7-10,21,29-30H,11-15,28H2,1-4H3/b29-18+,30-25+/t21-/m0/s1 |
| InChIKey | OWXCZBUKHFZPCP-CSFAWUSKSA-N |
| XLogP | 3.65 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|