C34H33ClN6O3S — CID 171795175
1-[4-[(2-aminophenyl)carbamoyl]phenyl]ethyl 2-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate (PubChem CID 171795175) has the molecular formula C34H33ClN6O3S and a molecular weight of 641.20 g/mol. Its IUPAC name is 1-[4-[(2-aminophenyl)carbamoyl]phenyl]ethyl 2-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate.
| Compound Name | 1-[4-[(2-aminophenyl)carbamoyl]phenyl]ethyl 2-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
|---|---|
| PubChem CID | 171795175 |
| Molecular Formula | C34H33ClN6O3S |
| Molecular Weight | 641.20 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | 1-[4-[(2-aminophenyl)carbamoyl]phenyl]ethyl 2-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]acetate |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])C(CC(=O)OC(C)c2ccc(C(=O)Nc3ccccc3N)cc2)N=C(c2ccc(Cl)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C34H33ClN6O3S/c1-18-20(3)45-34-30(18)31(23-13-15-25(35)16-14-23)39-28(32(38)41(34)21(4)36)17-29(42)44-19(2)22-9-11-24(12-10-22)33(43)40-27-8-6-5-7-26(27)37/h5-16,19,28,36,38H,17,37H2,1-4H3,(H,40,43)/b36-21+,38-32+ |
| InChIKey | FKGUGPNPXAKGJG-BAUCVIFZSA-N |
| XLogP | 7.55 |
| TPSA | 144.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.20 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|