C28H26ClF2N5OS — CID 155017130
2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]-N-(2,2-difluoro-1,3-dihydroinden-5-yl)acetamide (PubChem CID 155017130) has the molecular formula C28H26ClF2N5OS and a molecular weight of 554.07 g/mol. Its IUPAC name is 2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]-N-(2,2-difluoro-1,3-dihydroinden-5-yl)acetamide.
| Compound Name | 2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]-N-(2,2-difluoro-1,3-dihydroinden-5-yl)acetamide |
|---|---|
| PubChem CID | 155017130 |
| Molecular Formula | C28H26ClF2N5OS |
| Molecular Weight | 554.07 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6,7-dimethyl-3H-thieno[2,3-e][1,4]diazepin-3-yl]-N-(2,2-difluoro-1,3-dihydroinden-5-yl)acetamide |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)Nc2ccc3c(c2)CC(F)(F)C3)N=C(c2ccc(Cl)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C28H26ClF2N5OS/c1-14-15(2)38-27-24(14)25(17-4-7-20(29)8-5-17)35-22(26(33)36(27)16(3)32)11-23(37)34-21-9-6-18-12-28(30,31)13-19(18)10-21/h4-10,22,32-33H,11-13H2,1-3H3,(H,34,37)/b32-16+,33-26+/t22-/m0/s1 |
| InChIKey | VRRVLWWIZSOLGE-ONEBFCBGSA-N |
| XLogP | 6.78 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.07 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|