C31H31ClN6OS — CID 161361270
2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6-methyl-7-(2-pyridin-3-ylethynyl)-3H-thieno[2,3-e][1,4]diazepin-3-yl]-1-(4-methylpiperidin-1-yl)ethanone (PubChem CID 161361270) has the molecular formula C31H31ClN6OS and a molecular weight of 571.15 g/mol. Its IUPAC name is 2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6-methyl-7-(2-pyridin-3-ylethynyl)-3H-thieno[2,3-e][1,4]diazepin-3-yl]-1-(4-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6-methyl-7-(2-pyridin-3-ylethynyl)-3H-thieno[2,3-e][1,4]diazepin-3-yl]-1-(4-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 161361270 |
| Molecular Formula | C31H31ClN6OS |
| Molecular Weight | 571.15 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-6-methyl-7-(2-pyridin-3-ylethynyl)-3H-thieno[2,3-e][1,4]diazepin-3-yl]-1-(4-methylpiperidin-1-yl)ethanone |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)N2CCC(C)CC2)N=C(c2ccc(Cl)cc2)c2c1sc(C#Cc1cccnc1)c2C |
| InChI | InChI=1S/C31H31ClN6OS/c1-19-12-15-37(16-13-19)27(39)17-25-30(34)38(21(3)33)31-28(29(36-25)23-7-9-24(32)10-8-23)20(2)26(40-31)11-6-22-5-4-14-35-18-22/h4-5,7-10,14,18-19,25,33-34H,12-13,15-17H2,1-3H3/b33-21+,34-30+/t25-/m0/s1 |
| InChIKey | GYIKIXVYBGOOJI-LPQLTVLESA-N |
| XLogP | 6.15 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.15 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|