C24H30ClN5O2 — CID 145272207
2-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]-N-ethylacetamide;ethane (PubChem CID 145272207) has the molecular formula C24H30ClN5O2 and a molecular weight of 455.99 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]-N-ethylacetamide;ethane.
| Compound Name | 2-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]-N-ethylacetamide;ethane |
|---|---|
| PubChem CID | 145272207 |
| Molecular Formula | C24H30ClN5O2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]-N-ethylacetamide;ethane |
| SMILES | CC.[H]/N=C(\C)N1/C(=N/[H])C(CC(=O)NCC)N=C(c2ccc(Cl)cc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C22H24ClN5O2.C2H6/c1-4-26-20(29)12-18-22(25)28(13(2)24)19-10-9-16(30-3)11-17(19)21(27-18)14-5-7-15(23)8-6-14;1-2/h5-11,18,24-25H,4,12H2,1-3H3,(H,26,29);1-2H3/b24-13+,25-22+; |
| InChIKey | FGJODDWXUCAHLZ-CYWVBVGISA-N |
| XLogP | 4.90 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|