C35H43ClN6O3S — CID 144853175
2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]-N-(1-methylpyrrolidin-3-yl)acetamide;4-(trimethyl-λ4-sulfanyl)benzaldehyde (PubChem CID 144853175) has the molecular formula C35H43ClN6O3S and a molecular weight of 663.29 g/mol. Its IUPAC name is 2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]-N-(1-methylpyrrolidin-3-yl)acetamide;4-(trimethyl-λ4-sulfanyl)benzaldehyde.
| Compound Name | 2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]-N-(1-methylpyrrolidin-3-yl)acetamide;4-(trimethyl-λ4-sulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 144853175 |
| Molecular Formula | C35H43ClN6O3S |
| Molecular Weight | 663.29 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | 2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]-N-(1-methylpyrrolidin-3-yl)acetamide;4-(trimethyl-λ4-sulfanyl)benzaldehyde |
| SMILES | CS(C)(C)c1ccc(C=O)cc1.[H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)NC2CCN(C)C2)N=C(c2ccc(Cl)cc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C25H29ClN6O2.C10H14OS/c1-15(27)32-22-9-8-19(34-3)12-20(22)24(16-4-6-17(26)7-5-16)30-21(25(32)28)13-23(33)29-18-10-11-31(2)14-18;1-12(2,3)10-6-4-9(8-11)5-7-10/h4-9,12,18,21,27-28H,10-11,13-14H2,1-3H3,(H,29,33);4-8H,1-3H3/b27-15+,28-25+;/t18?,21-;/m0./s1 |
| InChIKey | FARGYJAFZMGHPT-CROZZYCMSA-N |
| XLogP | 6.11 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.29 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|