C27H26ClN5O2 — CID 89426750
2-[(3S)-5-(4-chlorophenyl)-1-ethanehydrazonoyl-7-methoxy-2-methylidene-3H-1,4-benzodiazepin-3-yl]-N-phenylacetamide (PubChem CID 89426750) has the molecular formula C27H26ClN5O2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 2-[(3S)-5-(4-chlorophenyl)-1-ethanehydrazonoyl-7-methoxy-2-methylidene-3H-1,4-benzodiazepin-3-yl]-N-phenylacetamide.
| Compound Name | 2-[(3S)-5-(4-chlorophenyl)-1-ethanehydrazonoyl-7-methoxy-2-methylidene-3H-1,4-benzodiazepin-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 89426750 |
| Molecular Formula | C27H26ClN5O2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[(3S)-5-(4-chlorophenyl)-1-ethanehydrazonoyl-7-methoxy-2-methylidene-3H-1,4-benzodiazepin-3-yl]-N-phenylacetamide |
| SMILES | C=C1[C@H](CC(=O)Nc2ccccc2)N=C(c2ccc(Cl)cc2)c2cc(OC)ccc2N1/C(C)=N\N |
| InChI | InChI=1S/C27H26ClN5O2/c1-17-24(16-26(34)30-21-7-5-4-6-8-21)31-27(19-9-11-20(28)12-10-19)23-15-22(35-3)13-14-25(23)33(17)18(2)32-29/h4-15,24H,1,16,29H2,2-3H3,(H,30,34)/b32-18-/t24-/m0/s1 |
| InChIKey | QPJTWCKOQPXXDC-KZAZFDFFSA-N |
| XLogP | 5.21 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|