C27H27BClN5O4 — CID 90365162
[3-[[[2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]acetyl]amino]methyl]phenyl]boronic acid (PubChem CID 90365162) has the molecular formula C27H27BClN5O4 and a molecular weight of 531.81 g/mol. Its IUPAC name is [3-[[[2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]acetyl]amino]methyl]phenyl]boronic acid.
| Compound Name | [3-[[[2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]acetyl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 90365162 |
| Molecular Formula | C27H27BClN5O4 |
| Molecular Weight | 531.81 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | [3-[[[2-[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-2-imino-7-methoxy-3H-1,4-benzodiazepin-3-yl]acetyl]amino]methyl]phenyl]boronic acid |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)NCc2cccc(B(O)O)c2)N=C(c2ccc(Cl)cc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C27H27BClN5O4/c1-16(30)34-24-11-10-21(38-2)13-22(24)26(18-6-8-20(29)9-7-18)33-23(27(34)31)14-25(35)32-15-17-4-3-5-19(12-17)28(36)37/h3-13,23,30-31,36-37H,14-15H2,1-2H3,(H,32,35)/b30-16+,31-27+/t23-/m0/s1 |
| InChIKey | SIDRCOXOKVPGGA-PBPVZULCSA-N |
| XLogP | 2.74 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.81 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|