C30H39ClN6O4 — CID 144853217
tert-butyl N-[4-[[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-3-[2-(ethylamino)-2-oxoethyl]-2-imino-3H-1,4-benzodiazepin-7-yl]oxy]butyl]carbamate (PubChem CID 144853217) has the molecular formula C30H39ClN6O4 and a molecular weight of 583.13 g/mol. Its IUPAC name is tert-butyl N-[4-[[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-3-[2-(ethylamino)-2-oxoethyl]-2-imino-3H-1,4-benzodiazepin-7-yl]oxy]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-3-[2-(ethylamino)-2-oxoethyl]-2-imino-3H-1,4-benzodiazepin-7-yl]oxy]butyl]carbamate |
|---|---|
| PubChem CID | 144853217 |
| Molecular Formula | C30H39ClN6O4 |
| Molecular Weight | 583.13 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | tert-butyl N-[4-[[(3S)-5-(4-chlorophenyl)-1-ethanimidoyl-3-[2-(ethylamino)-2-oxoethyl]-2-imino-3H-1,4-benzodiazepin-7-yl]oxy]butyl]carbamate |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](CC(=O)NCC)N=C(c2ccc(Cl)cc2)c2cc(OCCCCNC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C30H39ClN6O4/c1-6-34-26(38)18-24-28(33)37(19(2)32)25-14-13-22(40-16-8-7-15-35-29(39)41-30(3,4)5)17-23(25)27(36-24)20-9-11-21(31)12-10-20/h9-14,17,24,32-33H,6-8,15-16,18H2,1-5H3,(H,34,38)(H,35,39)/b32-19+,33-28+/t24-/m0/s1 |
| InChIKey | LLLPFFMBGLMNRA-REZAPJOMSA-N |
| XLogP | 5.55 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.13 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|