C26H38ClN5O2 — CID 145279445
1-[(3S)-5-(4-chlorophenyl)-3-ethyl-7-methoxy-2,3-dihydro-1,4-benzodiazepin-1-yl]ethanimine;formaldehyde;pentane-1,5-diamine (PubChem CID 145279445) has the molecular formula C26H38ClN5O2 and a molecular weight of 488.08 g/mol. Its IUPAC name is 1-[(3S)-5-(4-chlorophenyl)-3-ethyl-7-methoxy-2,3-dihydro-1,4-benzodiazepin-1-yl]ethanimine;formaldehyde;pentane-1,5-diamine.
| Compound Name | 1-[(3S)-5-(4-chlorophenyl)-3-ethyl-7-methoxy-2,3-dihydro-1,4-benzodiazepin-1-yl]ethanimine;formaldehyde;pentane-1,5-diamine |
|---|---|
| PubChem CID | 145279445 |
| Molecular Formula | C26H38ClN5O2 |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 1-[(3S)-5-(4-chlorophenyl)-3-ethyl-7-methoxy-2,3-dihydro-1,4-benzodiazepin-1-yl]ethanimine;formaldehyde;pentane-1,5-diamine |
| SMILES | C=O.NCCCCCN.[H]/N=C(\C)N1C[C@H](CC)N=C(c2ccc(Cl)cc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C20H22ClN3O.C5H14N2.CH2O/c1-4-16-12-24(13(2)22)19-10-9-17(25-3)11-18(19)20(23-16)14-5-7-15(21)8-6-14;6-4-2-1-3-5-7;1-2/h5-11,16,22H,4,12H2,1-3H3;1-7H2;1H2/b22-13+;;/t16-;;/m0../s1 |
| InChIKey | SWVGCLLHLOQTMX-BWHVVSAKSA-N |
| XLogP | 4.67 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|