C25H33ClN6O2 — CID 71291587
N-(5-aminopentyl)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetamide (PubChem CID 71291587) has the molecular formula C25H33ClN6O2 and a molecular weight of 485.03 g/mol. Its IUPAC name is N-(5-aminopentyl)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetamide.
| Compound Name | N-(5-aminopentyl)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetamide |
|---|---|
| PubChem CID | 71291587 |
| Molecular Formula | C25H33ClN6O2 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-(5-aminopentyl)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetamide |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCCCCN)C1NNC(C)N21 |
| InChI | InChI=1S/C25H33ClN6O2/c1-16-30-31-25-21(15-23(33)28-13-5-3-4-12-27)29-24(17-6-8-18(26)9-7-17)20-14-19(34-2)10-11-22(20)32(16)25/h6-11,14,16,21,25,30-31H,3-5,12-13,15,27H2,1-2H3,(H,28,33)/t16?,21-,25?/m0/s1 |
| InChIKey | IQDAKWKDMPPITC-MHVXWQKQSA-N |
| XLogP | 2.79 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|