C29H31ClN6O5 — CID 123581634
N-[2-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethyl]-2,3-dihydroxybenzamide (PubChem CID 123581634) has the molecular formula C29H31ClN6O5 and a molecular weight of 579.06 g/mol. Its IUPAC name is N-[2-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[2-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 123581634 |
| Molecular Formula | C29H31ClN6O5 |
| Molecular Weight | 579.06 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | N-[2-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethyl]-2,3-dihydroxybenzamide |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=NC(CC(=O)NCCNC(=O)c1cccc(O)c1O)C1NNC(C)N21 |
| InChI | InChI=1S/C29H31ClN6O5/c1-16-34-35-28-22(15-25(38)31-12-13-32-29(40)20-4-3-5-24(37)27(20)39)33-26(17-6-8-18(30)9-7-17)21-14-19(41-2)10-11-23(21)36(16)28/h3-11,14,16,22,28,34-35,37,39H,12-13,15H2,1-2H3,(H,31,38)(H,32,40) |
| InChIKey | PHFDKXLFQNCEJJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.06 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|