C35H36BClN6O5 — CID 78051326
[3-[3-[2-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethylcarbamoyl]phenyl]phenyl]boronic acid (PubChem CID 78051326) has the molecular formula C35H36BClN6O5 and a molecular weight of 666.98 g/mol. Its IUPAC name is [3-[3-[2-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethylcarbamoyl]phenyl]phenyl]boronic acid.
| Compound Name | [3-[3-[2-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethylcarbamoyl]phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 78051326 |
| Molecular Formula | C35H36BClN6O5 |
| Molecular Weight | 666.98 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | [3-[3-[2-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-2,3,3a,4-tetrahydro-1H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethylcarbamoyl]phenyl]phenyl]boronic acid |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=NC(CC(=O)NCCNC(=O)c1cccc(-c3cccc(B(O)O)c3)c1)C1NNC(C)N21 |
| InChI | InChI=1S/C35H36BClN6O5/c1-21-41-42-34-30(40-33(22-9-11-27(37)12-10-22)29-19-28(48-2)13-14-31(29)43(21)34)20-32(44)38-15-16-39-35(45)25-7-3-5-23(17-25)24-6-4-8-26(18-24)36(46)47/h3-14,17-19,21,30,34,41-42,46-47H,15-16,20H2,1-2H3,(H,38,44)(H,39,45) |
| InChIKey | QXVSUURKMRADRO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.98 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|