C25H31N5O5 — CID 144853761
N-ethylacetamide;methyl 2-[[1-ethanimidoyl-2-imino-5-(4-methoxyphenyl)-3H-1,4-benzodiazepin-7-yl]oxy]acetate (PubChem CID 144853761) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is N-ethylacetamide;methyl 2-[[1-ethanimidoyl-2-imino-5-(4-methoxyphenyl)-3H-1,4-benzodiazepin-7-yl]oxy]acetate.
| Compound Name | N-ethylacetamide;methyl 2-[[1-ethanimidoyl-2-imino-5-(4-methoxyphenyl)-3H-1,4-benzodiazepin-7-yl]oxy]acetate |
|---|---|
| PubChem CID | 144853761 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | N-ethylacetamide;methyl 2-[[1-ethanimidoyl-2-imino-5-(4-methoxyphenyl)-3H-1,4-benzodiazepin-7-yl]oxy]acetate |
| SMILES | CCNC(C)=O.[H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(OC)cc2)c2cc(OCC(=O)OC)ccc21 |
| InChI | InChI=1S/C21H22N4O4.C4H9NO/c1-13(22)25-18-9-8-16(29-12-20(26)28-3)10-17(18)21(24-11-19(25)23)14-4-6-15(27-2)7-5-14;1-3-5-4(2)6/h4-10,22-23H,11-12H2,1-3H3;3H2,1-2H3,(H,5,6)/b22-13+,23-19+; |
| InChIKey | HBQSMXCXKKLQKU-HNWAOUEHSA-N |
| XLogP | 3.02 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|