C24H23BN4OS — CID 144547625
5-[4-(4-boranylphenyl)sulfanylphenyl]-1-ethanimidoyl-7-methoxy-3H-1,4-benzodiazepin-2-imine (PubChem CID 144547625) has the molecular formula C24H23BN4OS and a molecular weight of 426.35 g/mol. Its IUPAC name is 5-[4-(4-boranylphenyl)sulfanylphenyl]-1-ethanimidoyl-7-methoxy-3H-1,4-benzodiazepin-2-imine.
| Compound Name | 5-[4-(4-boranylphenyl)sulfanylphenyl]-1-ethanimidoyl-7-methoxy-3H-1,4-benzodiazepin-2-imine |
|---|---|
| PubChem CID | 144547625 |
| Molecular Formula | C24H23BN4OS |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 5-[4-(4-boranylphenyl)sulfanylphenyl]-1-ethanimidoyl-7-methoxy-3H-1,4-benzodiazepin-2-imine |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(Sc3ccc(B)cc3)cc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C24H23BN4OS/c1-15(26)29-22-12-7-18(30-2)13-21(22)24(28-14-23(29)27)16-3-8-19(9-4-16)31-20-10-5-17(25)6-11-20/h3-13,26-27H,14,25H2,1-2H3/b26-15+,27-23+ |
| InChIKey | PMIUUELGFIKJRF-VJFFFQIWSA-N |
| XLogP | 3.74 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|