C26H27ClN4S — CID 144853430
5-(4-chlorophenyl)-1-ethanimidoyl-7-[3-(trimethyl-λ4-sulfanyl)phenyl]-3H-1,4-benzodiazepin-2-imine (PubChem CID 144853430) has the molecular formula C26H27ClN4S and a molecular weight of 463.05 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-ethanimidoyl-7-[3-(trimethyl-λ4-sulfanyl)phenyl]-3H-1,4-benzodiazepin-2-imine.
| Compound Name | 5-(4-chlorophenyl)-1-ethanimidoyl-7-[3-(trimethyl-λ4-sulfanyl)phenyl]-3H-1,4-benzodiazepin-2-imine |
|---|---|
| PubChem CID | 144853430 |
| Molecular Formula | C26H27ClN4S |
| Molecular Weight | 463.05 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 5-(4-chlorophenyl)-1-ethanimidoyl-7-[3-(trimethyl-λ4-sulfanyl)phenyl]-3H-1,4-benzodiazepin-2-imine |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])CN=C(c2ccc(Cl)cc2)c2cc(-c3cccc(S(C)(C)C)c3)ccc21 |
| InChI | InChI=1S/C26H27ClN4S/c1-17(28)31-24-13-10-20(19-6-5-7-22(14-19)32(2,3)4)15-23(24)26(30-16-25(31)29)18-8-11-21(27)12-9-18/h5-15,28-29H,16H2,1-4H3/b28-17+,29-25+ |
| InChIKey | HMZJLMADMVPENP-FICTWZRTSA-N |
| XLogP | 6.69 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.05 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|