C21H25ClN4O2S — CID 145256249
(Z)-1-[(3S)-5-(4-chlorophenyl)-3-ethyl-6,7-dimethyl-2,3-dihydrothieno[2,3-e][1,4]diazepin-1-yl]-N-(methylideneamino)ethanimine;formic acid (PubChem CID 145256249) has the molecular formula C21H25ClN4O2S and a molecular weight of 432.98 g/mol. Its IUPAC name is (Z)-1-[(3S)-5-(4-chlorophenyl)-3-ethyl-6,7-dimethyl-2,3-dihydrothieno[2,3-e][1,4]diazepin-1-yl]-N-(methylideneamino)ethanimine;formic acid.
| Compound Name | (Z)-1-[(3S)-5-(4-chlorophenyl)-3-ethyl-6,7-dimethyl-2,3-dihydrothieno[2,3-e][1,4]diazepin-1-yl]-N-(methylideneamino)ethanimine;formic acid |
|---|---|
| PubChem CID | 145256249 |
| Molecular Formula | C21H25ClN4O2S |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (Z)-1-[(3S)-5-(4-chlorophenyl)-3-ethyl-6,7-dimethyl-2,3-dihydrothieno[2,3-e][1,4]diazepin-1-yl]-N-(methylideneamino)ethanimine;formic acid |
| SMILES | C=N/N=C(/C)N1C[C@H](CC)N=C(c2ccc(Cl)cc2)c2c1sc(C)c2C.O=CO |
| InChI | InChI=1S/C20H23ClN4S.CH2O2/c1-6-17-11-25(14(4)24-22-5)20-18(12(2)13(3)26-20)19(23-17)15-7-9-16(21)10-8-15;2-1-3/h7-10,17H,5-6,11H2,1-4H3;1H,(H,2,3)/b24-14-;/t17-;/m0./s1 |
| InChIKey | WRZQUOSYABKNQJ-LOZWLQHHSA-N |
| XLogP | 5.19 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|