C32H36N4S — CID 167232176
(Z)-1-[6,7-dimethyl-3-(2-methylidenebutyl)-5-[4-(4-prop-1-en-2-ylphenyl)phenyl]-2,3-dihydrothieno[2,3-e][1,4]diazepin-1-yl]-N-(methylideneamino)ethanimine (PubChem CID 167232176) has the molecular formula C32H36N4S and a molecular weight of 508.74 g/mol. Its IUPAC name is (Z)-1-[6,7-dimethyl-3-(2-methylidenebutyl)-5-[4-(4-prop-1-en-2-ylphenyl)phenyl]-2,3-dihydrothieno[2,3-e][1,4]diazepin-1-yl]-N-(methylideneamino)ethanimine.
| Compound Name | (Z)-1-[6,7-dimethyl-3-(2-methylidenebutyl)-5-[4-(4-prop-1-en-2-ylphenyl)phenyl]-2,3-dihydrothieno[2,3-e][1,4]diazepin-1-yl]-N-(methylideneamino)ethanimine |
|---|---|
| PubChem CID | 167232176 |
| Molecular Formula | C32H36N4S |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | (Z)-1-[6,7-dimethyl-3-(2-methylidenebutyl)-5-[4-(4-prop-1-en-2-ylphenyl)phenyl]-2,3-dihydrothieno[2,3-e][1,4]diazepin-1-yl]-N-(methylideneamino)ethanimine |
| SMILES | C=N/N=C(/C)N1CC(CC(=C)CC)N=C(c2ccc(-c3ccc(C(=C)C)cc3)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C32H36N4S/c1-9-21(4)18-29-19-36(24(7)35-33-8)32-30(22(5)23(6)37-32)31(34-29)28-16-14-27(15-17-28)26-12-10-25(11-13-26)20(2)3/h10-17,29H,2,4,8-9,18-19H2,1,3,5-7H3/b35-24- |
| InChIKey | LKYQUEVFLLOSNQ-BGDIREAQSA-N |
| XLogP | 8.48 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|