C25H26ClN5OS — CID 176938172
(E)-3-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-cyclopentylprop-2-enamide (PubChem CID 176938172) has the molecular formula C25H26ClN5OS and a molecular weight of 480.04 g/mol. Its IUPAC name is (E)-3-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-cyclopentylprop-2-enamide.
| Compound Name | (E)-3-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 176938172 |
| Molecular Formula | C25H26ClN5OS |
| Molecular Weight | 480.04 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | (E)-3-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-cyclopentylprop-2-enamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=NC(/C=C/C(=O)NC1CCCC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C25H26ClN5OS/c1-14-15(2)33-25-22(14)23(17-8-10-18(26)11-9-17)28-20(24-30-29-16(3)31(24)25)12-13-21(32)27-19-6-4-5-7-19/h8-13,19-20H,4-7H2,1-3H3,(H,27,32)/b13-12+ |
| InChIKey | SIGUVUFINNIPLI-OUKQBFOZSA-N |
| XLogP | 5.41 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.04 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|