C22H25ClN6O2S — CID 139662442
1-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-3-(4-hydroxybutyl)urea (PubChem CID 139662442) has the molecular formula C22H25ClN6O2S and a molecular weight of 473.00 g/mol. Its IUPAC name is 1-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-3-(4-hydroxybutyl)urea.
| Compound Name | 1-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-3-(4-hydroxybutyl)urea |
|---|---|
| PubChem CID | 139662442 |
| Molecular Formula | C22H25ClN6O2S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 1-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-3-(4-hydroxybutyl)urea |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=NC(NC(=O)NCCCCO)c1nnc(C)n1-2 |
| InChI | InChI=1S/C22H25ClN6O2S/c1-12-13(2)32-21-17(12)18(15-6-8-16(23)9-7-15)25-19(20-28-27-14(3)29(20)21)26-22(31)24-10-4-5-11-30/h6-9,19,30H,4-5,10-11H2,1-3H3,(H2,24,26,31) |
| InChIKey | REQSZVMSNZMQFX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|