C12H19N3 — CID 177040739
1,4-dimethyl-6-[(Z)-pent-2-en-2-yl]iminopyridin-3-amine (PubChem CID 177040739) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 1,4-dimethyl-6-[(Z)-pent-2-en-2-yl]iminopyridin-3-amine.
| Compound Name | 1,4-dimethyl-6-[(Z)-pent-2-en-2-yl]iminopyridin-3-amine |
|---|---|
| PubChem CID | 177040739 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1,4-dimethyl-6-[(Z)-pent-2-en-2-yl]iminopyridin-3-amine |
| SMILES | CC/C=C(C)\N=c1/cc(C)c(N)cn1C |
| InChI | InChI=1S/C12H19N3/c1-5-6-10(3)14-12-7-9(2)11(13)8-15(12)4/h6-8H,5,13H2,1-4H3/b10-6-,14-12+ |
| InChIKey | NJSKDUMZWNTCKQ-NVWBTOBJSA-N |
| XLogP | 2.13 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |