C28H35F5N6O2 — CID 177041422
5-(16-cyclopentyloxy-13-fluoro-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-2-fluoro-3-methyl-4-(trifluoromethyl)aniline;ethane (PubChem CID 177041422) has the molecular formula C28H35F5N6O2 and a molecular weight of 582.62 g/mol. Its IUPAC name is 5-(16-cyclopentyloxy-13-fluoro-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-2-fluoro-3-methyl-4-(trifluoromethyl)aniline;ethane.
| Compound Name | 5-(16-cyclopentyloxy-13-fluoro-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-2-fluoro-3-methyl-4-(trifluoromethyl)aniline;ethane |
|---|---|
| PubChem CID | 177041422 |
| Molecular Formula | C28H35F5N6O2 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 5-(16-cyclopentyloxy-13-fluoro-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-2-fluoro-3-methyl-4-(trifluoromethyl)aniline;ethane |
| SMILES | CC.Cc1c(F)c(N)cc(-c2nc3c4c(nc(OC5CCCC5)nc4c2F)NCCNCCC(C)O3)c1C(F)(F)F |
| InChI | InChI=1S/C26H29F5N6O2.C2H6/c1-12-7-8-33-9-10-34-23-17-22(36-25(37-23)39-14-5-3-4-6-14)20(28)21(35-24(17)38-12)15-11-16(32)19(27)13(2)18(15)26(29,30)31;1-2/h11-12,14,33H,3-10,32H2,1-2H3,(H,34,36,37);1-2H3 |
| InChIKey | AOUBHELHDQZYQK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|