C26H33F5N6O2 — CID 177041684
ethane;2-fluoro-5-(13-fluoro-8-methyl-16-propan-2-yloxy-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-3-methyl-4-(trifluoromethyl)aniline (PubChem CID 177041684) has the molecular formula C26H33F5N6O2 and a molecular weight of 556.58 g/mol. Its IUPAC name is ethane;2-fluoro-5-(13-fluoro-8-methyl-16-propan-2-yloxy-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-3-methyl-4-(trifluoromethyl)aniline.
| Compound Name | ethane;2-fluoro-5-(13-fluoro-8-methyl-16-propan-2-yloxy-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-3-methyl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 177041684 |
| Molecular Formula | C26H33F5N6O2 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | ethane;2-fluoro-5-(13-fluoro-8-methyl-16-propan-2-yloxy-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-3-methyl-4-(trifluoromethyl)aniline |
| SMILES | CC.Cc1c(F)c(N)cc(-c2nc3c4c(nc(OC(C)C)nc4c2F)NCCNCCC(C)O3)c1C(F)(F)F |
| InChI | InChI=1S/C24H27F5N6O2.C2H6/c1-10(2)36-23-34-20-15-21(35-23)32-8-7-31-6-5-11(3)37-22(15)33-19(18(20)26)13-9-14(30)17(25)12(4)16(13)24(27,28)29;1-2/h9-11,31H,5-8,30H2,1-4H3,(H,32,34,35);1-2H3 |
| InChIKey | POTSGMJOSLQHLN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|