C21H21F5N6O2 — CID 170594469
2-fluoro-5-(13-fluoro-16-methoxy-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-4-(trifluoromethyl)aniline (PubChem CID 170594469) has the molecular formula C21H21F5N6O2 and a molecular weight of 484.43 g/mol. Its IUPAC name is 2-fluoro-5-(13-fluoro-16-methoxy-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-fluoro-5-(13-fluoro-16-methoxy-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 170594469 |
| Molecular Formula | C21H21F5N6O2 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-fluoro-5-(13-fluoro-16-methoxy-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-4-(trifluoromethyl)aniline |
| SMILES | COc1nc2c3c(nc(-c4cc(N)c(F)cc4C(F)(F)F)c(F)c3n1)OC(C)CCNCCN2 |
| InChI | InChI=1S/C21H21F5N6O2/c1-9-3-4-28-5-6-29-18-14-17(31-20(32-18)33-2)15(23)16(30-19(14)34-9)10-7-13(27)12(22)8-11(10)21(24,25)26/h7-9,28H,3-6,27H2,1-2H3,(H,29,31,32) |
| InChIKey | VSUZFSUAEDVIPZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|