C22H21F7N6O2 — CID 170594935
3-(13-fluoro-16-methoxy-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-4,5-bis(trifluoromethyl)aniline (PubChem CID 170594935) has the molecular formula C22H21F7N6O2 and a molecular weight of 534.44 g/mol. Its IUPAC name is 3-(13-fluoro-16-methoxy-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-4,5-bis(trifluoromethyl)aniline.
| Compound Name | 3-(13-fluoro-16-methoxy-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-4,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 170594935 |
| Molecular Formula | C22H21F7N6O2 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 3-(13-fluoro-16-methoxy-8-methyl-9-oxa-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaen-12-yl)-4,5-bis(trifluoromethyl)aniline |
| SMILES | COc1nc2c3c(nc(-c4cc(N)cc(C(F)(F)F)c4C(F)(F)F)c(F)c3n1)OC(C)CCNCCN2 |
| InChI | InChI=1S/C22H21F7N6O2/c1-9-3-4-31-5-6-32-18-13-17(34-20(35-18)36-2)15(23)16(33-19(13)37-9)11-7-10(30)8-12(21(24,25)26)14(11)22(27,28)29/h7-9,31H,3-6,30H2,1-2H3,(H,32,34,35) |
| InChIKey | YQLJGOOWIAYSSO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|