C14H17ClFN5O2S — CID 177041954
7-chloro-8-fluoro-2-methylsulfanyl-5-(1-piperazin-2-ylethoxy)-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 177041954) has the molecular formula C14H17ClFN5O2S and a molecular weight of 373.84 g/mol. Its IUPAC name is 7-chloro-8-fluoro-2-methylsulfanyl-5-(1-piperazin-2-ylethoxy)-3H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 7-chloro-8-fluoro-2-methylsulfanyl-5-(1-piperazin-2-ylethoxy)-3H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 177041954 |
| Molecular Formula | C14H17ClFN5O2S |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 7-chloro-8-fluoro-2-methylsulfanyl-5-(1-piperazin-2-ylethoxy)-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | CSc1nc2c(F)c(Cl)nc(OC(C)C3CNCCN3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H17ClFN5O2S/c1-6(7-5-17-3-4-18-7)23-13-8-10(9(16)11(15)20-13)19-14(24-2)21-12(8)22/h6-7,17-18H,3-5H2,1-2H3,(H,19,21,22) |
| InChIKey | BCDMSZSHAWAEOU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|