About piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine
piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine (PubChem CID 177052848) has the molecular formula C19H36N4O
and a molecular weight of 336.52 g/mol. Its IUPAC name is piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine.
Molecular Properties
| Compound Name | piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine |
| PubChem CID | 177052848 |
| Molecular Formula | C19H36N4O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine |
| SMILES | C#CCOC1CCN(CC2CCNCC2)CC1.NC1CCNCC1 |
| InChI | InChI=1S/C14H24N2O.C5H12N2/c1-2-11-17-14-5-9-16(10-6-14)12-13-3-7-15-8-4-13;6-5-1-3-7-4-2-5/h1,13-15H,3-12H2;5,7H,1-4,6H2 |
| InChIKey | ODKLRHRNLKPYTE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine?
The IUPAC name of piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine (CID 177052848) is piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine.
What is the SMILES notation for piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine?
The canonical SMILES for piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine is C#CCOC1CCN(CC2CCNCC2)CC1.NC1CCNCC1.
What is the InChIKey of piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine?
The InChIKey is ODKLRHRNLKPYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O.C5H12N2/c1-2-11-17-14-5-9-16(10-6-14)12-13-3-7-15-8-4-13;6-5-1-3-7-4-2-5/h1,13-15H,3-12H2;5,7H,1-4,6H2.
What are the key properties of piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine?
piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine has a molecular weight of 336.52 g/mol, XLogP of 0.80, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-amine;1-(piperidin-4-ylmethyl)-4-prop-2-ynoxypiperidine is sourced from PubChem (CID 177052848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).