C10H9NO2 — CID 177053381
5,6-bis(ethenyl)-3-hydroxypyridine-2-carbaldehyde (PubChem CID 177053381) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-3-hydroxypyridine-2-carbaldehyde.
| Compound Name | 5,6-bis(ethenyl)-3-hydroxypyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 177053381 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 5,6-bis(ethenyl)-3-hydroxypyridine-2-carbaldehyde |
| SMILES | C=Cc1cc(O)c(C=O)nc1C=C |
| InChI | InChI=1S/C10H9NO2/c1-3-7-5-10(13)9(6-12)11-8(7)4-2/h3-6,13H,1-2H2 |
| InChIKey | JVLKVTSMBVACSD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|