About (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine
(4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine (PubChem CID 177054028) has the molecular formula C8H14FN
and a molecular weight of 143.21 g/mol. Its IUPAC name is (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine.
Analyze (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine?
The IUPAC name of (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine (CID 177054028) is (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine.
What is the SMILES notation for (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine?
The canonical SMILES for (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine is C/C(F)=C1/CC(C)N(C)C1.
What is the InChIKey of (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine?
The InChIKey is GERKAJWZPAJWBE-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H14FN/c1-6-4-8(7(2)9)5-10(6)3/h6H,4-5H2,1-3H3/b8-7+.
What are the key properties of (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine?
(4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine has a molecular weight of 143.21 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-(1-fluoroethylidene)-1,2-dimethylpyrrolidine is sourced from PubChem (CID 177054028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).