C12H21N3 — CID 177054140
(Z)-5-(3-propylpyrrolidin-1-yl)pent-2-ene-1,4-diimine (PubChem CID 177054140) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (Z)-5-(3-propylpyrrolidin-1-yl)pent-2-ene-1,4-diimine.
| Compound Name | (Z)-5-(3-propylpyrrolidin-1-yl)pent-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 177054140 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (Z)-5-(3-propylpyrrolidin-1-yl)pent-2-ene-1,4-diimine |
| SMILES | [H]/N=C/C=C\C(CN1CCC(CCC)C1)=N/[H] |
| InChI | InChI=1S/C12H21N3/c1-2-4-11-6-8-15(9-11)10-12(14)5-3-7-13/h3,5,7,11,13-14H,2,4,6,8-10H2,1H3/b5-3-,13-7+,14-12+ |
| InChIKey | RVEAMCIYKLMOJJ-LMUFKFMZSA-N |
| XLogP | 2.33 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|