C11H18N2 — CID 123784648
4-(3-methylpyrrolidin-1-yl)cyclohex-2-en-1-imine (PubChem CID 123784648) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-(3-methylpyrrolidin-1-yl)cyclohex-2-en-1-imine.
| Compound Name | 4-(3-methylpyrrolidin-1-yl)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123784648 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4-(3-methylpyrrolidin-1-yl)cyclohex-2-en-1-imine |
| SMILES | [H]/N=C1/C=CC(N2CCC(C)C2)CC1 |
| InChI | InChI=1S/C11H18N2/c1-9-6-7-13(8-9)11-4-2-10(12)3-5-11/h2,4,9,11-12H,3,5-8H2,1H3/b12-10- |
| InChIKey | CNSYXTNZCHKJLS-BENRWUELSA-N |
| XLogP | 2.07 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|