C27H26N4O4S — CID 177054248
(2R)-1-[(2R)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-2-pyridin-3-ylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 177054248) has the molecular formula C27H26N4O4S and a molecular weight of 502.60 g/mol. Its IUPAC name is (2R)-1-[(2R)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-2-pyridin-3-ylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(2R)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-2-pyridin-3-ylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 177054248 |
| Molecular Formula | C27H26N4O4S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (2R)-1-[(2R)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-2-pyridin-3-ylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCn1c(S[C@@](C)(C(=O)N2CCC[C@@H]2C(=O)O)c2cccnc2)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C27H26N4O4S/c1-3-30-23(32)20-14-17-8-4-5-9-18(17)15-21(20)29-26(30)36-27(2,19-10-6-12-28-16-19)25(35)31-13-7-11-22(31)24(33)34/h4-6,8-10,12,14-16,22H,3,7,11,13H2,1-2H3,(H,33,34)/t22-,27-/m1/s1 |
| InChIKey | HCZMFXKRZBRYRE-AJTFRIOCSA-N |
| XLogP | 4.05 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|