C11H20FNO — CID 177059582
ethene;1-[(3S)-3-fluoro-5,5-dimethylpiperidin-3-yl]ethanone (PubChem CID 177059582) has the molecular formula C11H20FNO and a molecular weight of 201.28 g/mol. Its IUPAC name is ethene;1-[(3S)-3-fluoro-5,5-dimethylpiperidin-3-yl]ethanone.
| Compound Name | ethene;1-[(3S)-3-fluoro-5,5-dimethylpiperidin-3-yl]ethanone |
|---|---|
| PubChem CID | 177059582 |
| Molecular Formula | C11H20FNO |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | ethene;1-[(3S)-3-fluoro-5,5-dimethylpiperidin-3-yl]ethanone |
| SMILES | C=C.CC(=O)[C@@]1(F)CNCC(C)(C)C1 |
| InChI | InChI=1S/C9H16FNO.C2H4/c1-7(12)9(10)4-8(2,3)5-11-6-9;1-2/h11H,4-6H2,1-3H3;1-2H2/t9-;/m0./s1 |
| InChIKey | NXTOWTACRNPZOS-FVGYRXGTSA-N |
| XLogP | 2.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|