C29H17EuF3N2O4 — CID 177066216
europium;4-hydroxy-7-phenyl-3-(2,2,2-trifluoroacetyl)chromen-2-one;1,10-phenanthroline (PubChem CID 177066216) has the molecular formula C29H17EuF3N2O4 and a molecular weight of 666.42 g/mol. Its IUPAC name is europium;4-hydroxy-7-phenyl-3-(2,2,2-trifluoroacetyl)chromen-2-one;1,10-phenanthroline.
| Compound Name | europium;4-hydroxy-7-phenyl-3-(2,2,2-trifluoroacetyl)chromen-2-one;1,10-phenanthroline |
|---|---|
| PubChem CID | 177066216 |
| Molecular Formula | C29H17EuF3N2O4 |
| Molecular Weight | 666.42 g/mol |
| Exact Mass | 667.04 |
| IUPAC Name | europium;4-hydroxy-7-phenyl-3-(2,2,2-trifluoroacetyl)chromen-2-one;1,10-phenanthroline |
| SMILES | O=C(c1c(O)c2ccc(-c3ccccc3)cc2oc1=O)C(F)(F)F.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C17H9F3O4.C12H8N2.Eu/c18-17(19,20)15(22)13-14(21)11-7-6-10(8-12(11)24-16(13)23)9-4-2-1-3-5-9;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-8,21H;1-8H; |
| InChIKey | IOPPDBMFORBWSY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.42 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|