C38H33EuF3NO4P — CID 177066358
1-bis(2-methylphenyl)phosphoryl-2-methylbenzene;1-ethyl-4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]quinolin-2-one;europium (PubChem CID 177066358) has the molecular formula C38H33EuF3NO4P and a molecular weight of 807.62 g/mol. Its IUPAC name is 1-bis(2-methylphenyl)phosphoryl-2-methylbenzene;1-ethyl-4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]quinolin-2-one;europium.
| Compound Name | 1-bis(2-methylphenyl)phosphoryl-2-methylbenzene;1-ethyl-4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]quinolin-2-one;europium |
|---|---|
| PubChem CID | 177066358 |
| Molecular Formula | C38H33EuF3NO4P |
| Molecular Weight | 807.62 g/mol |
| Exact Mass | 808.13 |
| IUPAC Name | 1-bis(2-methylphenyl)phosphoryl-2-methylbenzene;1-ethyl-4-hydroxy-3-(2,2,2-trifluoroacetyl)benzo[h]quinolin-2-one;europium |
| SMILES | CCn1c(=O)c(C(=O)C(F)(F)F)c(O)c2ccc3ccccc3c21.Cc1ccccc1P(=O)(c1ccccc1C)c1ccccc1C.[Eu] |
| InChI | InChI=1S/C21H21OP.C17H12F3NO3.Eu/c1-16-10-4-7-13-19(16)23(22,20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3;1-2-21-13-10-6-4-3-5-9(10)7-8-11(13)14(22)12(16(21)24)15(23)17(18,19)20;/h4-15H,1-3H3;3-8,22H,2H2,1H3; |
| InChIKey | CRUUTCWUNSNQEL-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.62 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|