C64H67N — CID 177067898
N-[4-(6,8-ditert-butyl-9,9-dicyclopentylfluoren-1-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 177067898) has the molecular formula C64H67N and a molecular weight of 850.25 g/mol. Its IUPAC name is N-[4-(6,8-ditert-butyl-9,9-dicyclopentylfluoren-1-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | N-[4-(6,8-ditert-butyl-9,9-dicyclopentylfluoren-1-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 177067898 |
| Molecular Formula | C64H67N |
| Molecular Weight | 850.25 g/mol |
| Exact Mass | 849.53 |
| IUPAC Name | N-[4-(6,8-ditert-butyl-9,9-dicyclopentylfluoren-1-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)C(C1CCCC1)(C1CCCC1)c1c(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3)cccc1-2 |
| InChI | InChI=1S/C64H67N/c1-61(2,3)47-39-55-54-27-18-26-51(59(54)64(45-21-12-13-22-45,46-23-14-15-24-46)60(55)58(40-47)62(4,5)6)44-31-35-49(36-32-44)65(48-33-29-43(30-34-48)42-19-10-9-11-20-42)50-37-38-53-52-25-16-17-28-56(52)63(7,8)57(53)41-50/h9-11,16-20,25-41,45-46H,12-15,21-24H2,1-8H3 |
| InChIKey | KNWSUPCGYTYJBG-UHFFFAOYSA-N |
| XLogP | 18.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.25 |
| LogP ≤ 5 | 18.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |