C16H15F3O2 — CID 177076526
1,2,3-trifluoro-5-(3-methoxy-4-propan-2-ylphenoxy)benzene (PubChem CID 177076526) has the molecular formula C16H15F3O2 and a molecular weight of 296.29 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-(3-methoxy-4-propan-2-ylphenoxy)benzene.
| Compound Name | 1,2,3-trifluoro-5-(3-methoxy-4-propan-2-ylphenoxy)benzene |
|---|---|
| PubChem CID | 177076526 |
| Molecular Formula | C16H15F3O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1,2,3-trifluoro-5-(3-methoxy-4-propan-2-ylphenoxy)benzene |
| SMILES | COc1cc(Oc2cc(F)c(F)c(F)c2)ccc1C(C)C |
| InChI | InChI=1S/C16H15F3O2/c1-9(2)12-5-4-10(8-15(12)20-3)21-11-6-13(17)16(19)14(18)7-11/h4-9H,1-3H3 |
| InChIKey | IBVRUBAMUUOMIO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|